C16H11F5N2O2 — CID 58148276
5-methyl-2-[3-(2,2,3,3,3-pentafluoropropoxy)-4-pyridinyl]-1,3-benzoxazole (PubChem CID 58148276) has the molecular formula C16H11F5N2O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 5-methyl-2-[3-(2,2,3,3,3-pentafluoropropoxy)-4-pyridinyl]-1,3-benzoxazole.
| Compound Name | 5-methyl-2-[3-(2,2,3,3,3-pentafluoropropoxy)-4-pyridinyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 58148276 |
| Molecular Formula | C16H11F5N2O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 5-methyl-2-[3-(2,2,3,3,3-pentafluoropropoxy)-4-pyridinyl]-1,3-benzoxazole |
| SMILES | Cc1ccc2oc(-c3ccncc3OCC(F)(F)C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C16H11F5N2O2/c1-9-2-3-12-11(6-9)23-14(25-12)10-4-5-22-7-13(10)24-8-15(17,18)16(19,20)21/h2-7H,8H2,1H3 |
| InChIKey | PUJFDZULZVTPMP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|