C17H18N2O3 — CID 58148158
2-[3-(2-ethoxyethoxy)-4-pyridinyl]-5-methyl-1,3-benzoxazole (PubChem CID 58148158) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[3-(2-ethoxyethoxy)-4-pyridinyl]-5-methyl-1,3-benzoxazole.
| Compound Name | 2-[3-(2-ethoxyethoxy)-4-pyridinyl]-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 58148158 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[3-(2-ethoxyethoxy)-4-pyridinyl]-5-methyl-1,3-benzoxazole |
| SMILES | CCOCCOc1cnccc1-c1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C17H18N2O3/c1-3-20-8-9-21-16-11-18-7-6-13(16)17-19-14-10-12(2)4-5-15(14)22-17/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | UKKGADOXUBYRFY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|