C16H9F7N2O2 — CID 87195881
2-[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]-5-(trifluoromethyl)-1,3-benzoxazole (PubChem CID 87195881) has the molecular formula C16H9F7N2O2 and a molecular weight of 394.25 g/mol. Its IUPAC name is 2-[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]-5-(trifluoromethyl)-1,3-benzoxazole.
| Compound Name | 2-[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]-5-(trifluoromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 87195881 |
| Molecular Formula | C16H9F7N2O2 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]-5-(trifluoromethyl)-1,3-benzoxazole |
| SMILES | FC(F)C(F)(F)COc1cnccc1-c1nc2cc(C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C16H9F7N2O2/c17-14(18)15(19,20)7-26-12-6-24-4-3-9(12)13-25-10-5-8(16(21,22)23)1-2-11(10)27-13/h1-6,14H,7H2 |
| InChIKey | DXCNJLNBAZBBAD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|