C18H17F3N2O3 — CID 129159223
2-[3-(3-methoxypropoxy)-4-pyridinyl]-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole (PubChem CID 129159223) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-[3-(3-methoxypropoxy)-4-pyridinyl]-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole.
| Compound Name | 2-[3-(3-methoxypropoxy)-4-pyridinyl]-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 129159223 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[3-(3-methoxypropoxy)-4-pyridinyl]-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole |
| SMILES | COCCCOc1cnccc1-c1nc2cc(CC(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-24-7-2-8-25-16-11-22-6-5-13(16)17-23-14-9-12(10-18(19,20)21)3-4-15(14)26-17/h3-6,9,11H,2,7-8,10H2,1H3 |
| InChIKey | MRNCZLUNONLUIW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|