C17H11F3N2O4S2 — CID 178157387
2-(3-ethylsulfonyl-5-ethynyl-2-pyridinyl)-5-(trifluoromethylsulfinyl)-1,3-benzoxazole (PubChem CID 178157387) has the molecular formula C17H11F3N2O4S2 and a molecular weight of 428.41 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-5-ethynyl-2-pyridinyl)-5-(trifluoromethylsulfinyl)-1,3-benzoxazole.
| Compound Name | 2-(3-ethylsulfonyl-5-ethynyl-2-pyridinyl)-5-(trifluoromethylsulfinyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 178157387 |
| Molecular Formula | C17H11F3N2O4S2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 2-(3-ethylsulfonyl-5-ethynyl-2-pyridinyl)-5-(trifluoromethylsulfinyl)-1,3-benzoxazole |
| SMILES | C#Cc1cnc(-c2nc3cc(S(=O)C(F)(F)F)ccc3o2)c(S(=O)(=O)CC)c1 |
| InChI | InChI=1S/C17H11F3N2O4S2/c1-3-10-7-14(28(24,25)4-2)15(21-9-10)16-22-12-8-11(5-6-13(12)26-16)27(23)17(18,19)20/h1,5-9H,4H2,2H3 |
| InChIKey | AWKCWDORAMVVNG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|