C16H15NO4S2 — CID 118100358
2-(2-ethylsulfonylphenyl)-5-methylsulfinyl-1,3-benzoxazole (PubChem CID 118100358) has the molecular formula C16H15NO4S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-(2-ethylsulfonylphenyl)-5-methylsulfinyl-1,3-benzoxazole.
| Compound Name | 2-(2-ethylsulfonylphenyl)-5-methylsulfinyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 118100358 |
| Molecular Formula | C16H15NO4S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-(2-ethylsulfonylphenyl)-5-methylsulfinyl-1,3-benzoxazole |
| SMILES | CCS(=O)(=O)c1ccccc1-c1nc2cc(S(C)=O)ccc2o1 |
| InChI | InChI=1S/C16H15NO4S2/c1-3-23(19,20)15-7-5-4-6-12(15)16-17-13-10-11(22(2)18)8-9-14(13)21-16/h4-10H,3H2,1-2H3 |
| InChIKey | QQOFOZDLRTWMGS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |