C17H31ClN2O — CID 142399959
1-[1-(3-chlorophenyl)ethyl]-2-[3-(2-methylpropoxy)propyl]hydrazine;ethane (PubChem CID 142399959) has the molecular formula C17H31ClN2O and a molecular weight of 314.90 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-2-[3-(2-methylpropoxy)propyl]hydrazine;ethane.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-2-[3-(2-methylpropoxy)propyl]hydrazine;ethane |
|---|---|
| PubChem CID | 142399959 |
| Molecular Formula | C17H31ClN2O |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-2-[3-(2-methylpropoxy)propyl]hydrazine;ethane |
| SMILES | CC.CC(C)COCCCNNC(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H25ClN2O.C2H6/c1-12(2)11-19-9-5-8-17-18-13(3)14-6-4-7-15(16)10-14;1-2/h4,6-7,10,12-13,17-18H,5,8-9,11H2,1-3H3;1-2H3 |
| InChIKey | WXISWXVKFDQEFQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|