C17H31FN2O2 — CID 142400019
ethane;1-(3-ethoxypropyl)-2-[1-[3-(2-fluoroethoxy)phenyl]ethyl]hydrazine (PubChem CID 142400019) has the molecular formula C17H31FN2O2 and a molecular weight of 314.45 g/mol. Its IUPAC name is ethane;1-(3-ethoxypropyl)-2-[1-[3-(2-fluoroethoxy)phenyl]ethyl]hydrazine.
| Compound Name | ethane;1-(3-ethoxypropyl)-2-[1-[3-(2-fluoroethoxy)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 142400019 |
| Molecular Formula | C17H31FN2O2 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | ethane;1-(3-ethoxypropyl)-2-[1-[3-(2-fluoroethoxy)phenyl]ethyl]hydrazine |
| SMILES | CC.CCOCCCNNC(C)c1cccc(OCCF)c1 |
| InChI | InChI=1S/C15H25FN2O2.C2H6/c1-3-19-10-5-9-17-18-13(2)14-6-4-7-15(12-14)20-11-8-16;1-2/h4,6-7,12-13,17-18H,3,5,8-11H2,1-2H3;1-2H3 |
| InChIKey | UXDJJICFMLLOAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|