C22H25ClO6 — CID 142400085
benzyl 2-(3-chloropropyl)-1,3-dioxolane-4-carboxylate;benzyl formate (PubChem CID 142400085) has the molecular formula C22H25ClO6 and a molecular weight of 420.89 g/mol. Its IUPAC name is benzyl 2-(3-chloropropyl)-1,3-dioxolane-4-carboxylate;benzyl formate.
| Compound Name | benzyl 2-(3-chloropropyl)-1,3-dioxolane-4-carboxylate;benzyl formate |
|---|---|
| PubChem CID | 142400085 |
| Molecular Formula | C22H25ClO6 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | benzyl 2-(3-chloropropyl)-1,3-dioxolane-4-carboxylate;benzyl formate |
| SMILES | O=C(OCc1ccccc1)C1COC(CCCCl)O1.O=COCc1ccccc1 |
| InChI | InChI=1S/C14H17ClO4.C8H8O2/c15-8-4-7-13-17-10-12(19-13)14(16)18-9-11-5-2-1-3-6-11;9-7-10-6-8-4-2-1-3-5-8/h1-3,5-6,12-13H,4,7-10H2;1-5,7H,6H2 |
| InChIKey | IAJDCQWFIQIDHZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|