C28H54N4O8 — CID 142400131
butane;tert-butyl 4-[4-amino-2-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxobutyl]piperazine-1-carboxylate;methyl hexanoate (PubChem CID 142400131) has the molecular formula C28H54N4O8 and a molecular weight of 574.76 g/mol. Its IUPAC name is butane;tert-butyl 4-[4-amino-2-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxobutyl]piperazine-1-carboxylate;methyl hexanoate.
| Compound Name | butane;tert-butyl 4-[4-amino-2-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxobutyl]piperazine-1-carboxylate;methyl hexanoate |
|---|---|
| PubChem CID | 142400131 |
| Molecular Formula | C28H54N4O8 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | butane;tert-butyl 4-[4-amino-2-[(2-methoxy-2-oxoethyl)carbamoyl]-4-oxobutyl]piperazine-1-carboxylate;methyl hexanoate |
| SMILES | CCCC.CCCCCC(=O)OC.COC(=O)CNC(=O)C(CC(N)=O)CN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H30N4O6.C7H14O2.C4H10/c1-17(2,3)27-16(25)21-7-5-20(6-8-21)11-12(9-13(18)22)15(24)19-10-14(23)26-4;1-3-4-5-6-7(8)9-2;1-3-4-2/h12H,5-11H2,1-4H3,(H2,18,22)(H,19,24);3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | FNVYMKLNBNOVMU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 157.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|