C17H18N4O3 — CID 142402015
ethyl 3-methanimidoyl-4-(pyridin-4-ylmethylcarbamoylamino)benzoate (PubChem CID 142402015) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is ethyl 3-methanimidoyl-4-(pyridin-4-ylmethylcarbamoylamino)benzoate.
| Compound Name | ethyl 3-methanimidoyl-4-(pyridin-4-ylmethylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 142402015 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 3-methanimidoyl-4-(pyridin-4-ylmethylcarbamoylamino)benzoate |
| SMILES | [H]/N=C/c1cc(C(=O)OCC)ccc1NC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C17H18N4O3/c1-2-24-16(22)13-3-4-15(14(9-13)10-18)21-17(23)20-11-12-5-7-19-8-6-12/h3-10,18H,2,11H2,1H3,(H2,20,21,23)/b18-10+ |
| InChIKey | OUSGTHZUOHELGD-VCHYOVAHSA-N |
| XLogP | 2.58 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|