C10H19F2N3O2 — CID 142404443
N-carbamoyl-3,3-difluoro-1-methylpiperidine-4-carboxamide;ethane (PubChem CID 142404443) has the molecular formula C10H19F2N3O2 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-carbamoyl-3,3-difluoro-1-methylpiperidine-4-carboxamide;ethane.
| Compound Name | N-carbamoyl-3,3-difluoro-1-methylpiperidine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 142404443 |
| Molecular Formula | C10H19F2N3O2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-carbamoyl-3,3-difluoro-1-methylpiperidine-4-carboxamide;ethane |
| SMILES | CC.CN1CCC(C(=O)NC(N)=O)C(F)(F)C1 |
| InChI | InChI=1S/C8H13F2N3O2.C2H6/c1-13-3-2-5(8(9,10)4-13)6(14)12-7(11)15;1-2/h5H,2-4H2,1H3,(H3,11,12,14,15);1-2H3 |
| InChIKey | XUOSONOUOVKGHV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |