C12H26N2O — CID 166075526
ethane;N,1,3,3-tetramethylpiperidine-4-carboxamide (PubChem CID 166075526) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is ethane;N,1,3,3-tetramethylpiperidine-4-carboxamide.
| Compound Name | ethane;N,1,3,3-tetramethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166075526 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | ethane;N,1,3,3-tetramethylpiperidine-4-carboxamide |
| SMILES | CC.CNC(=O)C1CCN(C)CC1(C)C |
| InChI | InChI=1S/C10H20N2O.C2H6/c1-10(2)7-12(4)6-5-8(10)9(13)11-3;1-2/h8H,5-7H2,1-4H3,(H,11,13);1-2H3 |
| InChIKey | SQFXNGQYMNGQLU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |