C30H36N4O3 — CID 142408159
acetic acid;[4-[[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]methyl]-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]-phenylmethanone (PubChem CID 142408159) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is acetic acid;[4-[[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]methyl]-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]-phenylmethanone.
| Compound Name | acetic acid;[4-[[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]methyl]-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]-phenylmethanone |
|---|---|
| PubChem CID | 142408159 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | acetic acid;[4-[[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]methyl]-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-yl]-phenylmethanone |
| SMILES | CC(=O)O.CCN(N)c1ccc(Cc2ccc3c(c2)C2CCC(C3)N2C(=O)c2ccccc2)c(C)c1N |
| InChI | InChI=1S/C28H32N4O.C2H4O2/c1-3-31(30)26-13-11-21(18(2)27(26)29)15-19-9-10-22-17-23-12-14-25(24(22)16-19)32(23)28(33)20-7-5-4-6-8-20;1-2(3)4/h4-11,13,16,23,25H,3,12,14-15,17,29-30H2,1-2H3;1H3,(H,3,4) |
| InChIKey | RUDXHTSZCGLYCZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|