C16H18FN3O4S — CID 142410527
5-(ethylsulfamoyl)-N-(5-fluoro-6-methyl-2-pyridinyl)-2-methoxybenzamide (PubChem CID 142410527) has the molecular formula C16H18FN3O4S and a molecular weight of 367.40 g/mol. Its IUPAC name is 5-(ethylsulfamoyl)-N-(5-fluoro-6-methyl-2-pyridinyl)-2-methoxybenzamide.
| Compound Name | 5-(ethylsulfamoyl)-N-(5-fluoro-6-methyl-2-pyridinyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 142410527 |
| Molecular Formula | C16H18FN3O4S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 5-(ethylsulfamoyl)-N-(5-fluoro-6-methyl-2-pyridinyl)-2-methoxybenzamide |
| SMILES | CCNS(=O)(=O)c1ccc(OC)c(C(=O)Nc2ccc(F)c(C)n2)c1 |
| InChI | InChI=1S/C16H18FN3O4S/c1-4-18-25(22,23)11-5-7-14(24-3)12(9-11)16(21)20-15-8-6-13(17)10(2)19-15/h5-9,18H,4H2,1-3H3,(H,19,20,21) |
| InChIKey | PRKICLFXXIBMNY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |