C20H25FN2O5S — CID 55932340
N-(2-butoxy-5-methoxyphenyl)-5-(ethylsulfamoyl)-2-fluorobenzamide (PubChem CID 55932340) has the molecular formula C20H25FN2O5S and a molecular weight of 424.49 g/mol. Its IUPAC name is N-(2-butoxy-5-methoxyphenyl)-5-(ethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-(2-butoxy-5-methoxyphenyl)-5-(ethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 55932340 |
| Molecular Formula | C20H25FN2O5S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-(2-butoxy-5-methoxyphenyl)-5-(ethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)c1cc(S(=O)(=O)NCC)ccc1F |
| InChI | InChI=1S/C20H25FN2O5S/c1-4-6-11-28-19-10-7-14(27-3)12-18(19)23-20(24)16-13-15(8-9-17(16)21)29(25,26)22-5-2/h7-10,12-13,22H,4-6,11H2,1-3H3,(H,23,24) |
| InChIKey | ALBVQJRXXCQPFO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|