C30H27FN4O7 — CID 142413610
1-N'-[3-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 142413610) has the molecular formula C30H27FN4O7 and a molecular weight of 574.57 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 142413610 |
| Molecular Formula | C30H27FN4O7 |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 1-N'-[3-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | COCCOc1cc2ncnc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccccc5)CC4)cc3F)c2c2c1OCCO2 |
| InChI | InChI=1S/C30H27FN4O7/c1-38-11-12-39-23-16-21-24(26-25(23)40-13-14-41-26)27(33-17-32-21)42-22-8-7-19(15-20(22)31)35-29(37)30(9-10-30)28(36)34-18-5-3-2-4-6-18/h2-8,15-17H,9-14H2,1H3,(H,34,36)(H,35,37) |
| InChIKey | MGQBSTAKSJQDLS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|