C19H18FN3O4 — CID 127051046
N-(4-fluorophenyl)-5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine (PubChem CID 127051046) has the molecular formula C19H18FN3O4 and a molecular weight of 371.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine.
| Compound Name | N-(4-fluorophenyl)-5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine |
|---|---|
| PubChem CID | 127051046 |
| Molecular Formula | C19H18FN3O4 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(4-fluorophenyl)-5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(F)cc3)c2c2c1OCCO2 |
| InChI | InChI=1S/C19H18FN3O4/c1-24-6-7-25-15-10-14-16(18-17(15)26-8-9-27-18)19(22-11-21-14)23-13-4-2-12(20)3-5-13/h2-5,10-11H,6-9H2,1H3,(H,21,22,23) |
| InChIKey | GHDLYUNTQJYIGQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|