C15H16ClNO4 — CID 139405902
10-chloro-5-(2-methoxyethoxy)-9-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline (PubChem CID 139405902) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is 10-chloro-5-(2-methoxyethoxy)-9-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline.
| Compound Name | 10-chloro-5-(2-methoxyethoxy)-9-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline |
|---|---|
| PubChem CID | 139405902 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 10-chloro-5-(2-methoxyethoxy)-9-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline |
| SMILES | COCCOc1cc2ncc(C)c(Cl)c2c2c1OCCO2 |
| InChI | InChI=1S/C15H16ClNO4/c1-9-8-17-10-7-11(19-4-3-18-2)14-15(12(10)13(9)16)21-6-5-20-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | QKSKZBSVDUMAGQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|