C21H21FN2O5 — CID 162425165
5-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]-2-methylaniline (PubChem CID 162425165) has the molecular formula C21H21FN2O5 and a molecular weight of 400.41 g/mol. Its IUPAC name is 5-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]-2-methylaniline.
| Compound Name | 5-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]-2-methylaniline |
|---|---|
| PubChem CID | 162425165 |
| Molecular Formula | C21H21FN2O5 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 5-fluoro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]-2-methylaniline |
| SMILES | COCCOc1cc2nccc(Oc3cc(C)c(N)cc3F)c2c2c1OCCO2 |
| InChI | InChI=1S/C21H21FN2O5/c1-12-9-17(13(22)10-14(12)23)29-16-3-4-24-15-11-18(26-6-5-25-2)20-21(19(15)16)28-8-7-27-20/h3-4,9-11H,5-8,23H2,1-2H3 |
| InChIKey | CNKFISIVBVLPRJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|