C23H24ClFN4O4 — CID 127049195
N-(3-chloro-4-fluorophenyl)-5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine (PubChem CID 127049195) has the molecular formula C23H24ClFN4O4 and a molecular weight of 474.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine |
|---|---|
| PubChem CID | 127049195 |
| Molecular Formula | C23H24ClFN4O4 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-amine |
| SMILES | Fc1ccc(Nc2ncnc3cc(OCCCN4CCOCC4)c4c(c23)OCCO4)cc1Cl |
| InChI | InChI=1S/C23H24ClFN4O4/c24-16-12-15(2-3-17(16)25)28-23-20-18(26-14-27-23)13-19(21-22(20)33-11-10-32-21)31-7-1-4-29-5-8-30-9-6-29/h2-3,12-14H,1,4-11H2,(H,26,27,28) |
| InChIKey | NVESEOKYLHXNPU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|