C21H22ClF2N5O — CID 10812706
N-(3-chloro-4-fluorophenyl)-6-fluoro-7-(4-morpholin-4-ylbutyl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 10812706) has the molecular formula C21H22ClF2N5O and a molecular weight of 433.89 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-fluoro-7-(4-morpholin-4-ylbutyl)pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-fluoro-7-(4-morpholin-4-ylbutyl)pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10812706 |
| Molecular Formula | C21H22ClF2N5O |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-fluoro-7-(4-morpholin-4-ylbutyl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3cc(CCCCN4CCOCC4)c(F)nc23)cc1Cl |
| InChI | InChI=1S/C21H22ClF2N5O/c22-16-12-15(4-5-17(16)23)27-21-19-18(25-13-26-21)11-14(20(24)28-19)3-1-2-6-29-7-9-30-10-8-29/h4-5,11-13H,1-3,6-10H2,(H,25,26,27) |
| InChIKey | ZEPAONSNMYEHFB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|