C22H23ClFN5O3S — CID 18176148
N-(3-chloro-4-fluorophenyl)-6-[(E)-5-morpholin-4-ylpent-1-enyl]sulfonylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 18176148) has the molecular formula C22H23ClFN5O3S and a molecular weight of 491.98 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-[(E)-5-morpholin-4-ylpent-1-enyl]sulfonylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-[(E)-5-morpholin-4-ylpent-1-enyl]sulfonylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18176148 |
| Molecular Formula | C22H23ClFN5O3S |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-[(E)-5-morpholin-4-ylpent-1-enyl]sulfonylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | O=S(=O)(/C=C/CCCN1CCOCC1)c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cn1 |
| InChI | InChI=1S/C22H23ClFN5O3S/c23-18-12-16(4-5-19(18)24)28-22-17-13-21(25-14-20(17)26-15-27-22)33(30,31)11-3-1-2-6-29-7-9-32-10-8-29/h3-5,11-15H,1-2,6-10H2,(H,26,27,28)/b11-3+ |
| InChIKey | UBUMKKKPNWAARS-QDEBKDIKSA-N |
| XLogP | 3.96 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|