C24H29ClFN5 — CID 167034840
N-(3-chloro-4-fluorophenyl)-7-ethyl-6-(4-piperazin-1-ylbutyl)quinazolin-4-amine (PubChem CID 167034840) has the molecular formula C24H29ClFN5 and a molecular weight of 441.98 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-ethyl-6-(4-piperazin-1-ylbutyl)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-ethyl-6-(4-piperazin-1-ylbutyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 167034840 |
| Molecular Formula | C24H29ClFN5 |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-ethyl-6-(4-piperazin-1-ylbutyl)quinazolin-4-amine |
| SMILES | CCc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CCCCN1CCNCC1 |
| InChI | InChI=1S/C24H29ClFN5/c1-2-17-14-23-20(13-18(17)5-3-4-10-31-11-8-27-9-12-31)24(29-16-28-23)30-19-6-7-22(26)21(25)15-19/h6-7,13-16,27H,2-5,8-12H2,1H3,(H,28,29,30) |
| InChIKey | JISQJZQGJQSHHR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|