C27H32ClFN4 — CID 142811109
6-[[4-(but-3-enylamino)cyclohexyl]methyl]-N-(3-chloro-4-fluorophenyl)-7-ethylquinazolin-4-amine (PubChem CID 142811109) has the molecular formula C27H32ClFN4 and a molecular weight of 467.03 g/mol. Its IUPAC name is 6-[[4-(but-3-enylamino)cyclohexyl]methyl]-N-(3-chloro-4-fluorophenyl)-7-ethylquinazolin-4-amine.
| Compound Name | 6-[[4-(but-3-enylamino)cyclohexyl]methyl]-N-(3-chloro-4-fluorophenyl)-7-ethylquinazolin-4-amine |
|---|---|
| PubChem CID | 142811109 |
| Molecular Formula | C27H32ClFN4 |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 6-[[4-(but-3-enylamino)cyclohexyl]methyl]-N-(3-chloro-4-fluorophenyl)-7-ethylquinazolin-4-amine |
| SMILES | C=CCCNC1CCC(Cc2cc3c(Nc4ccc(F)c(Cl)c4)ncnc3cc2CC)CC1 |
| InChI | InChI=1S/C27H32ClFN4/c1-3-5-12-30-21-8-6-18(7-9-21)13-20-14-23-26(15-19(20)4-2)31-17-32-27(23)33-22-10-11-25(29)24(28)16-22/h3,10-11,14-18,21,30H,1,4-9,12-13H2,2H3,(H,31,32,33) |
| InChIKey | ITGOPLASQIAKFU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|