C28H26ClF2N7O4 — CID 162671939
N-[4-(3-chloro-4-fluoroanilino)-7-(3-piperazin-1-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide (PubChem CID 162671939) has the molecular formula C28H26ClF2N7O4 and a molecular weight of 598.01 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(3-piperazin-1-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(3-piperazin-1-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 162671939 |
| Molecular Formula | C28H26ClF2N7O4 |
| Molecular Weight | 598.01 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(3-piperazin-1-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide |
| SMILES | O=C(Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCCN1CCNCC1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C28H26ClF2N7O4/c29-21-12-17(2-4-23(21)31)35-27-20-14-25(36-28(39)19-13-18(38(40)41)3-5-22(19)30)26(15-24(20)33-16-34-27)42-11-1-8-37-9-6-32-7-10-37/h2-5,12-16,32H,1,6-11H2,(H,36,39)(H,33,34,35) |
| InChIKey | ZILKTDJCFGYUHY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|