C29H25ClFN7O5 — CID 162666749
N-[4-(3-chloro-4-cyanoanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide (PubChem CID 162666749) has the molecular formula C29H25ClFN7O5 and a molecular weight of 606.01 g/mol. Its IUPAC name is N-[4-(3-chloro-4-cyanoanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide.
| Compound Name | N-[4-(3-chloro-4-cyanoanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 162666749 |
| Molecular Formula | C29H25ClFN7O5 |
| Molecular Weight | 606.01 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | N-[4-(3-chloro-4-cyanoanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]-2-fluoro-5-nitrobenzamide |
| SMILES | N#Cc1ccc(Nc2ncnc3cc(OCCCN4CCOCC4)c(NC(=O)c4cc([N+](=O)[O-])ccc4F)cc23)cc1Cl |
| InChI | InChI=1S/C29H25ClFN7O5/c30-23-12-19(3-2-18(23)16-32)35-28-22-14-26(36-29(39)21-13-20(38(40)41)4-5-24(21)31)27(15-25(22)33-17-34-28)43-9-1-6-37-7-10-42-11-8-37/h2-5,12-15,17H,1,6-11H2,(H,36,39)(H,33,34,35) |
| InChIKey | GBVQKTBBELXOAA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 155.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|