C26H20N2 — CID 142415982
2-cyclohexa-1,5-dien-1-yl-4-(3-phenylphenyl)quinazoline (PubChem CID 142415982) has the molecular formula C26H20N2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-(3-phenylphenyl)quinazoline.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-(3-phenylphenyl)quinazoline |
|---|---|
| PubChem CID | 142415982 |
| Molecular Formula | C26H20N2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-(3-phenylphenyl)quinazoline |
| SMILES | C1=CC(c2nc(-c3cccc(-c4ccccc4)c3)c3ccccc3n2)=CCC1 |
| InChI | InChI=1S/C26H20N2/c1-3-10-19(11-4-1)21-14-9-15-22(18-21)25-23-16-7-8-17-24(23)27-26(28-25)20-12-5-2-6-13-20/h1,3-5,7-18H,2,6H2 |
| InChIKey | ZLCRGSVOCCBJSB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |