C20H15BrN2 — CID 134432211
2-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-ylquinazoline (PubChem CID 134432211) has the molecular formula C20H15BrN2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-ylquinazoline.
| Compound Name | 2-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-ylquinazoline |
|---|---|
| PubChem CID | 134432211 |
| Molecular Formula | C20H15BrN2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-ylquinazoline |
| SMILES | Brc1cccc(-c2nc(C3=CCCC=C3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H15BrN2/c21-16-10-6-9-15(13-16)20-22-18-12-5-4-11-17(18)19(23-20)14-7-2-1-3-8-14/h2,4-13H,1,3H2 |
| InChIKey | KENRZVSBABOLIA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |