C26H25BrN2 — CID 144696850
5-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidine;(Z)-but-2-ene (PubChem CID 144696850) has the molecular formula C26H25BrN2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 5-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidine;(Z)-but-2-ene.
| Compound Name | 5-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidine;(Z)-but-2-ene |
|---|---|
| PubChem CID | 144696850 |
| Molecular Formula | C26H25BrN2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 5-(3-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-2-phenylpyrimidine;(Z)-but-2-ene |
| SMILES | Brc1cccc(-c2cnc(-c3ccccc3)nc2C2=CCCC=C2)c1.C/C=C\C |
| InChI | InChI=1S/C22H17BrN2.C4H8/c23-19-13-7-12-18(14-19)20-15-24-22(17-10-5-2-6-11-17)25-21(20)16-8-3-1-4-9-16;1-3-4-2/h2-3,5-15H,1,4H2;3-4H,1-2H3/b;4-3- |
| InChIKey | CPZFTKRCCLMGIK-QGAMPUOQSA-N |
| XLogP | 7.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|