C21H17N — CID 140797896
1-cyclohexa-1,5-dien-1-yl-4-phenylisoquinoline (PubChem CID 140797896) has the molecular formula C21H17N and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-phenylisoquinoline.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-phenylisoquinoline |
|---|---|
| PubChem CID | 140797896 |
| Molecular Formula | C21H17N |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-phenylisoquinoline |
| SMILES | C1=CC(c2ncc(-c3ccccc3)c3ccccc23)=CCC1 |
| InChI | InChI=1S/C21H17N/c1-3-9-16(10-4-1)20-15-22-21(17-11-5-2-6-12-17)19-14-8-7-13-18(19)20/h1,3-5,7-15H,2,6H2 |
| InChIKey | RVGYVTMDGUQMJM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |