C30H46N4 — CID 142416683
(E)-N'-cyclohexyl-N-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline (PubChem CID 142416683) has the molecular formula C30H46N4 and a molecular weight of 462.73 g/mol. Its IUPAC name is (E)-N'-cyclohexyl-N-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline.
| Compound Name | (E)-N'-cyclohexyl-N-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 142416683 |
| Molecular Formula | C30H46N4 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | (E)-N'-cyclohexyl-N-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline |
| SMILES | C1=C2CCCCC2=NCC1.C1=CC2=C(C=CC1)CC(CNC/C=C/CNC1CCCCC1)NC2 |
| InChI | InChI=1S/C21H33N3.C9H13N/c1-3-9-18-15-21(24-16-19(18)10-4-1)17-22-13-7-8-14-23-20-11-5-2-6-12-20;1-2-6-9-8(4-1)5-3-7-10-9/h3-4,7-10,20-24H,1-2,5-6,11-17H2;5H,1-4,6-7H2/b8-7+; |
| InChIKey | AFPGTMLYNVMWDC-USRGLUTNSA-N |
| XLogP | 5.56 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|