C22H18N4 — CID 170518923
6,9,15,26-tetrazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-2(7),3,8(13),11,15,17,19,21,23,25-decaene (PubChem CID 170518923) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6,9,15,26-tetrazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-2(7),3,8(13),11,15,17,19,21,23,25-decaene.
| Compound Name | 6,9,15,26-tetrazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-2(7),3,8(13),11,15,17,19,21,23,25-decaene |
|---|---|
| PubChem CID | 170518923 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6,9,15,26-tetrazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-2(7),3,8(13),11,15,17,19,21,23,25-decaene |
| SMILES | C1=CC2=C(NC1)C1=C(C=CCN1)C1N=c3cc4ccccc4cc3=NC21 |
| InChI | InChI=1S/C22H18N4/c1-2-6-14-12-18-17(11-13(14)5-1)25-21-15-7-3-9-23-19(15)20-16(22(21)26-18)8-4-10-24-20/h1-8,11-12,21-24H,9-10H2 |
| InChIKey | UTXQKWABHBQSNQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |