C31H48N4 — CID 142416669
(E)-N-(cyclohexylmethyl)-N'-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline (PubChem CID 142416669) has the molecular formula C31H48N4 and a molecular weight of 476.75 g/mol. Its IUPAC name is (E)-N-(cyclohexylmethyl)-N'-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline.
| Compound Name | (E)-N-(cyclohexylmethyl)-N'-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 142416669 |
| Molecular Formula | C31H48N4 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | (E)-N-(cyclohexylmethyl)-N'-(2,3,4,7-tetrahydro-1H-cyclohepta[c]pyridin-3-ylmethyl)but-2-ene-1,4-diamine;2,3,5,6,7,8-hexahydroquinoline |
| SMILES | C1=C2CCCCC2=NCC1.C1=CC2=C(C=CC1)CC(CNC/C=C/CNCC1CCCCC1)NC2 |
| InChI | InChI=1S/C22H35N3.C9H13N/c1-3-9-19(10-4-1)16-23-13-7-8-14-24-18-22-15-20-11-5-2-6-12-21(20)17-25-22;1-2-6-9-8(4-1)5-3-7-10-9/h5-8,11-12,19,22-25H,1-4,9-10,13-18H2;5H,1-4,6-7H2/b8-7+; |
| InChIKey | KEZAWYBMZMUNQU-USRGLUTNSA-N |
| XLogP | 5.81 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|