C28H47N5 — CID 6396147
N-[2-[[cyclohexyl(1,2-dihydropyridin-6-yl)methylidene]amino]ethyl]-2-[[cyclohexyl(piperidin-2-yl)methylidene]amino]ethanamine (PubChem CID 6396147) has the molecular formula C28H47N5 and a molecular weight of 453.72 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(1,2-dihydropyridin-6-yl)methylidene]amino]ethyl]-2-[[cyclohexyl(piperidin-2-yl)methylidene]amino]ethanamine.
| Compound Name | N-[2-[[cyclohexyl(1,2-dihydropyridin-6-yl)methylidene]amino]ethyl]-2-[[cyclohexyl(piperidin-2-yl)methylidene]amino]ethanamine |
|---|---|
| PubChem CID | 6396147 |
| Molecular Formula | C28H47N5 |
| Molecular Weight | 453.72 g/mol |
| Exact Mass | 453.38 |
| IUPAC Name | N-[2-[[cyclohexyl(1,2-dihydropyridin-6-yl)methylidene]amino]ethyl]-2-[[cyclohexyl(piperidin-2-yl)methylidene]amino]ethanamine |
| SMILES | C1=CCNC(/C(=N/CCNCC/N=C(\C2CCCCC2)C2CCCCN2)C2CCCCC2)=C1 |
| InChI | InChI=1S/C28H47N5/c1-3-11-23(12-4-1)27(25-15-7-9-17-30-25)32-21-19-29-20-22-33-28(24-13-5-2-6-14-24)26-16-8-10-18-31-26/h7,9,15,23-24,26,29-31H,1-6,8,10-14,16-22H2/b32-27+,33-28+ |
| InChIKey | SYROBRWYZXQRQF-MOEPYEHSSA-N |
| XLogP | 4.80 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|