C16H20ClFN4S — CID 142417323
(Z)-4-[3-chloro-4-[3-(dimethylaminosulfanyl)phenyl]-5-methylpyrazol-1-yl]-3-fluorobut-2-en-1-amine (PubChem CID 142417323) has the molecular formula C16H20ClFN4S and a molecular weight of 354.88 g/mol. Its IUPAC name is (Z)-4-[3-chloro-4-[3-(dimethylaminosulfanyl)phenyl]-5-methylpyrazol-1-yl]-3-fluorobut-2-en-1-amine.
| Compound Name | (Z)-4-[3-chloro-4-[3-(dimethylaminosulfanyl)phenyl]-5-methylpyrazol-1-yl]-3-fluorobut-2-en-1-amine |
|---|---|
| PubChem CID | 142417323 |
| Molecular Formula | C16H20ClFN4S |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (Z)-4-[3-chloro-4-[3-(dimethylaminosulfanyl)phenyl]-5-methylpyrazol-1-yl]-3-fluorobut-2-en-1-amine |
| SMILES | Cc1c(-c2cccc(SN(C)C)c2)c(Cl)nn1C/C(F)=C/CN |
| InChI | InChI=1S/C16H20ClFN4S/c1-11-15(12-5-4-6-14(9-12)23-21(2)3)16(17)20-22(11)10-13(18)7-8-19/h4-7,9H,8,10,19H2,1-3H3/b13-7- |
| InChIKey | CCUMZYLYHUMFPQ-QPEQYQDCSA-N |
| XLogP | 3.89 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|