C11H11N3 — CID 14241961
6-methyl-3-(4-methylphenyl)-1,2,4-triazine (PubChem CID 14241961) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 6-methyl-3-(4-methylphenyl)-1,2,4-triazine.
| Compound Name | 6-methyl-3-(4-methylphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 14241961 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 6-methyl-3-(4-methylphenyl)-1,2,4-triazine |
| SMILES | Cc1ccc(-c2ncc(C)nn2)cc1 |
| InChI | InChI=1S/C11H11N3/c1-8-3-5-10(6-4-8)11-12-7-9(2)13-14-11/h3-7H,1-2H3 |
| InChIKey | FLXJCSFOAJFJTI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |