C18H23F2N3O — CID 142423707
(2E,3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-4-prop-1-en-2-ylocta-3,5,7-trienenitrile (PubChem CID 142423707) has the molecular formula C18H23F2N3O and a molecular weight of 335.40 g/mol. Its IUPAC name is (2E,3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-4-prop-1-en-2-ylocta-3,5,7-trienenitrile.
| Compound Name | (2E,3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-4-prop-1-en-2-ylocta-3,5,7-trienenitrile |
|---|---|
| PubChem CID | 142423707 |
| Molecular Formula | C18H23F2N3O |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (2E,3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-2-ethylidene-4-prop-1-en-2-ylocta-3,5,7-trienenitrile |
| SMILES | C=C/C(N)=C(NC1CCOCC1(F)F)\C(=C\C(C#N)=C/C)C(=C)C |
| InChI | InChI=1S/C18H23F2N3O/c1-5-13(10-21)9-14(12(3)4)17(15(22)6-2)23-16-7-8-24-11-18(16,19)20/h5-6,9,16,23H,2-3,7-8,11,22H2,1,4H3/b13-5+,14-9+,17-15- |
| InChIKey | FAEWJQXTYCJJEC-KLWCJAJQSA-N |
| XLogP | 3.33 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|