C14H12F3N5S — CID 142423879
S-[(Z)-2-amino-3-[8-(trifluoromethyl)-3H-imidazo[4,5-c]quinolin-2-yl]prop-1-enyl]thiohydroxylamine (PubChem CID 142423879) has the molecular formula C14H12F3N5S and a molecular weight of 339.35 g/mol. Its IUPAC name is S-[(Z)-2-amino-3-[8-(trifluoromethyl)-3H-imidazo[4,5-c]quinolin-2-yl]prop-1-enyl]thiohydroxylamine.
| Compound Name | S-[(Z)-2-amino-3-[8-(trifluoromethyl)-3H-imidazo[4,5-c]quinolin-2-yl]prop-1-enyl]thiohydroxylamine |
|---|---|
| PubChem CID | 142423879 |
| Molecular Formula | C14H12F3N5S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | S-[(Z)-2-amino-3-[8-(trifluoromethyl)-3H-imidazo[4,5-c]quinolin-2-yl]prop-1-enyl]thiohydroxylamine |
| SMILES | NS/C=C(\N)Cc1nc2c(cnc3ccc(C(F)(F)F)cc32)[nH]1 |
| InChI | InChI=1S/C14H12F3N5S/c15-14(16,17)7-1-2-10-9(3-7)13-11(5-20-10)21-12(22-13)4-8(18)6-23-19/h1-3,5-6H,4,18-19H2,(H,21,22)/b8-6- |
| InChIKey | NLRMFZBWNLUZKK-VURMDHGXSA-N |
| XLogP | 3.08 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|