C20H20N6O2S2 — CID 142424151
N-(3-acetylphenyl)-2-[[5-(benzylcarbamothioylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 142424151) has the molecular formula C20H20N6O2S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[5-(benzylcarbamothioylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[[5-(benzylcarbamothioylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 142424151 |
| Molecular Formula | C20H20N6O2S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[5-(benzylcarbamothioylamino)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CSc2n[nH]c(NC(=S)NCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H20N6O2S2/c1-13(27)15-8-5-9-16(10-15)22-17(28)12-30-20-24-18(25-26-20)23-19(29)21-11-14-6-3-2-4-7-14/h2-10H,11-12H2,1H3,(H,22,28)(H3,21,23,24,25,26,29) |
| InChIKey | CSRPVUNIGSSBJW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|