C21H20ClN7O2 — CID 142425471
1-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3-[4-(1-ethoxyethyl)quinolin-3-yl]urea (PubChem CID 142425471) has the molecular formula C21H20ClN7O2 and a molecular weight of 437.89 g/mol. Its IUPAC name is 1-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3-[4-(1-ethoxyethyl)quinolin-3-yl]urea.
| Compound Name | 1-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3-[4-(1-ethoxyethyl)quinolin-3-yl]urea |
|---|---|
| PubChem CID | 142425471 |
| Molecular Formula | C21H20ClN7O2 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3-[4-(1-ethoxyethyl)quinolin-3-yl]urea |
| SMILES | CCOC(C)c1c(NC(=O)Nc2cnc(-n3nccn3)c(Cl)c2)cnc2ccccc12 |
| InChI | InChI=1S/C21H20ClN7O2/c1-3-31-13(2)19-15-6-4-5-7-17(15)23-12-18(19)28-21(30)27-14-10-16(22)20(24-11-14)29-25-8-9-26-29/h4-13H,3H2,1-2H3,(H2,27,28,30) |
| InChIKey | VIEDYHVYKILSKN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |