C19H16Cl2N8O — CID 156772596
1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]urea (PubChem CID 156772596) has the molecular formula C19H16Cl2N8O and a molecular weight of 443.30 g/mol. Its IUPAC name is 1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]urea.
| Compound Name | 1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 156772596 |
| Molecular Formula | C19H16Cl2N8O |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]urea |
| SMILES | CC(C)c1c(NC(=O)Nc2cnc(-n3nccn3)c(Cl)c2)cnc2ccc(Cl)nc12 |
| InChI | InChI=1S/C19H16Cl2N8O/c1-10(2)16-14(9-22-13-3-4-15(21)28-17(13)16)27-19(30)26-11-7-12(20)18(23-8-11)29-24-5-6-25-29/h3-10H,1-2H3,(H2,26,27,30) |
| InChIKey | ITNMIEXZMXDDKE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|