C18H15ClF3N5O — CID 156772632
1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[2-(trifluoromethyl)-4-pyridinyl]urea (PubChem CID 156772632) has the molecular formula C18H15ClF3N5O and a molecular weight of 409.80 g/mol. Its IUPAC name is 1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[2-(trifluoromethyl)-4-pyridinyl]urea.
| Compound Name | 1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[2-(trifluoromethyl)-4-pyridinyl]urea |
|---|---|
| PubChem CID | 156772632 |
| Molecular Formula | C18H15ClF3N5O |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1-(6-chloro-4-propan-2-yl-1,5-naphthyridin-3-yl)-3-[2-(trifluoromethyl)-4-pyridinyl]urea |
| SMILES | CC(C)c1c(NC(=O)Nc2ccnc(C(F)(F)F)c2)cnc2ccc(Cl)nc12 |
| InChI | InChI=1S/C18H15ClF3N5O/c1-9(2)15-12(8-24-11-3-4-14(19)27-16(11)15)26-17(28)25-10-5-6-23-13(7-10)18(20,21)22/h3-9H,1-2H3,(H2,23,25,26,28) |
| InChIKey | ZKCJDAPOOKDEPY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|