C21H18ClF3N8O2 — CID 156772644
1-[6-chloro-4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]-3-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 156772644) has the molecular formula C21H18ClF3N8O2 and a molecular weight of 506.88 g/mol. Its IUPAC name is 1-[6-chloro-4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]-3-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-[6-chloro-4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]-3-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 156772644 |
| Molecular Formula | C21H18ClF3N8O2 |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 1-[6-chloro-4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]-3-[6-(triazol-2-yl)-5-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | CCOC(C)c1c(NC(=O)Nc2cnc(-n3nccn3)c(C(F)(F)F)c2)cnc2ccc(Cl)nc12 |
| InChI | InChI=1S/C21H18ClF3N8O2/c1-3-35-11(2)17-15(10-26-14-4-5-16(22)32-18(14)17)31-20(34)30-12-8-13(21(23,24)25)19(27-9-12)33-28-6-7-29-33/h4-11H,3H2,1-2H3,(H2,30,31,34) |
| InChIKey | GQYYWAPMUXKLQZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|