C19H15ClF2N6O3 — CID 166769830
1-[6-chloro-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]-3-[5-cyano-6-(difluoromethoxy)-3-pyridinyl]urea (PubChem CID 166769830) has the molecular formula C19H15ClF2N6O3 and a molecular weight of 448.82 g/mol. Its IUPAC name is 1-[6-chloro-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]-3-[5-cyano-6-(difluoromethoxy)-3-pyridinyl]urea.
| Compound Name | 1-[6-chloro-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]-3-[5-cyano-6-(difluoromethoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 166769830 |
| Molecular Formula | C19H15ClF2N6O3 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-[6-chloro-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]-3-[5-cyano-6-(difluoromethoxy)-3-pyridinyl]urea |
| SMILES | COC(C)c1c(NC(=O)Nc2cnc(OC(F)F)c(C#N)c2)cnc2ccc(Cl)nc12 |
| InChI | InChI=1S/C19H15ClF2N6O3/c1-9(30-2)15-13(8-24-12-3-4-14(20)28-16(12)15)27-19(29)26-11-5-10(6-23)17(25-7-11)31-18(21)22/h3-5,7-9,18H,1-2H3,(H2,26,27,29) |
| InChIKey | GAKIZHAMBVSPEW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|