C14H14FNO2 — CID 142425606
(NZ)-N-[2-cyclohexa-1,5-dien-1-yloxy-1-(4-fluorophenyl)ethylidene]hydroxylamine (PubChem CID 142425606) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is (NZ)-N-[2-cyclohexa-1,5-dien-1-yloxy-1-(4-fluorophenyl)ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-cyclohexa-1,5-dien-1-yloxy-1-(4-fluorophenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 142425606 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (NZ)-N-[2-cyclohexa-1,5-dien-1-yloxy-1-(4-fluorophenyl)ethylidene]hydroxylamine |
| SMILES | O/N=C(\COC1=CCCC=C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FNO2/c15-12-8-6-11(7-9-12)14(16-17)10-18-13-4-2-1-3-5-13/h2,4-9,17H,1,3,10H2/b16-14+ |
| InChIKey | ADONUJWODHARFP-JQIJEIRASA-N |
| XLogP | 3.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|