C26H56N2 — CID 142426443
ethane;4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;2-ethyl-N,N,3-trimethylcyclohexan-1-amine (PubChem CID 142426443) has the molecular formula C26H56N2 and a molecular weight of 396.75 g/mol. Its IUPAC name is ethane;4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;2-ethyl-N,N,3-trimethylcyclohexan-1-amine.
| Compound Name | ethane;4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;2-ethyl-N,N,3-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142426443 |
| Molecular Formula | C26H56N2 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 396.44 |
| IUPAC Name | ethane;4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;2-ethyl-N,N,3-trimethylcyclohexan-1-amine |
| SMILES | CC.CC.CCC1C(C)CCCC1N(C)C.CCC1CCNC2CCCCC12 |
| InChI | InChI=1S/C11H21N.C11H23N.2C2H6/c1-2-9-7-8-12-11-6-4-3-5-10(9)11;1-5-10-9(2)7-6-8-11(10)12(3)4;2*1-2/h9-12H,2-8H2,1H3;9-11H,5-8H2,1-4H3;2*1-2H3 |
| InChIKey | LJBFMZALPSQJDN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |