C10H20N2 — CID 142426553
2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-amine (PubChem CID 142426553) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-amine.
| Compound Name | 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-amine |
|---|---|
| PubChem CID | 142426553 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-amine |
| SMILES | CN1CCC2CCCCC2C1N |
| InChI | InChI=1S/C10H20N2/c1-12-7-6-8-4-2-3-5-9(8)10(12)11/h8-10H,2-7,11H2,1H3 |
| InChIKey | BVPQUWPIRAEEER-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |