C24H47NO5 — CID 142428413
N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2S)-2-ethyl-2-methoxy-5,6-dimethyl-4-methylideneoxane;1-methoxypropane (PubChem CID 142428413) has the molecular formula C24H47NO5 and a molecular weight of 429.64 g/mol. Its IUPAC name is N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2S)-2-ethyl-2-methoxy-5,6-dimethyl-4-methylideneoxane;1-methoxypropane.
| Compound Name | N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2S)-2-ethyl-2-methoxy-5,6-dimethyl-4-methylideneoxane;1-methoxypropane |
|---|---|
| PubChem CID | 142428413 |
| Molecular Formula | C24H47NO5 |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.35 |
| IUPAC Name | N-[(5,5-dimethyloxan-2-yl)methyl]formamide;(2S)-2-ethyl-2-methoxy-5,6-dimethyl-4-methylideneoxane;1-methoxypropane |
| SMILES | C=C1C[C@@](CC)(OC)OC(C)C1C.CC1(C)CCC(CNC=O)OC1.CCCOC |
| InChI | InChI=1S/C11H20O2.C9H17NO2.C4H10O/c1-6-11(12-5)7-8(2)9(3)10(4)13-11;1-9(2)4-3-8(12-6-9)5-10-7-11;1-3-4-5-2/h9-10H,2,6-7H2,1,3-5H3;7-8H,3-6H2,1-2H3,(H,10,11);3-4H2,1-2H3/t9?,10?,11-;;/m0../s1 |
| InChIKey | RGNNIFJTBFBTGT-MVJZERPBSA-N |
| XLogP | 4.72 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|