C25H47NO6 — CID 142428403
1-(5,5-dimethyloxan-2-yl)-N-methylmethanamine;2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetaldehyde;propyl acetate (PubChem CID 142428403) has the molecular formula C25H47NO6 and a molecular weight of 457.65 g/mol. Its IUPAC name is 1-(5,5-dimethyloxan-2-yl)-N-methylmethanamine;2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetaldehyde;propyl acetate.
| Compound Name | 1-(5,5-dimethyloxan-2-yl)-N-methylmethanamine;2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetaldehyde;propyl acetate |
|---|---|
| PubChem CID | 142428403 |
| Molecular Formula | C25H47NO6 |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.34 |
| IUPAC Name | 1-(5,5-dimethyloxan-2-yl)-N-methylmethanamine;2-[(2R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetaldehyde;propyl acetate |
| SMILES | C=C1C[C@@](CC=O)(OC)OC(C)C1C.CCCOC(C)=O.CNCC1CCC(C)(C)CO1 |
| InChI | InChI=1S/C11H18O3.C9H19NO.C5H10O2/c1-8-7-11(13-4,5-6-12)14-10(3)9(8)2;1-9(2)5-4-8(6-10-3)11-7-9;1-3-4-7-5(2)6/h6,9-10H,1,5,7H2,2-4H3;8,10H,4-7H2,1-3H3;3-4H2,1-2H3/t9?,10?,11-;;/m0../s1 |
| InChIKey | RXADRNOSTPVUDL-MVJZERPBSA-N |
| XLogP | 4.29 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|